cas: 115467-07-7 — see every product listed under this CAS number, including other names
5-Bromo-1,3-difluoro-2-(trifluoromethoxy)benzene 97% (CAS 115467-07-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A332587-500g |
| cas | 115467-07-7 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 8869.88 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 25g | 648.50 Pln | |
| Ambeed | 100g | 2267.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A332587 |
5-bromo-1,3-difluoro-2-(trifluoromethoxy)benzene (CAS 115467-07-7) is a chemical compound with the molecular formula C7H2BrF5O and a molecular weight of 276.99 g/mol. IUPAC name: 5-bromo-1,3-difluoro-2-(trifluoromethoxy)benzene. InChIKey: ORHCJZZKAUAZDR-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5O |
|---|---|
| Molecular weight | 276.99 g/mol |
| IUPAC name | 5-bromo-1,3-difluoro-2-(trifluoromethoxy)benzene |
| InChIKey | ORHCJZZKAUAZDR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OC(F)(F)F)F)Br |
Computed by PubChem (NCBI)