cas: 115467-07-7 — see every product listed under this CAS number, including other names
5-Bromo-1,3-difluoro-2-(trifluoromethoxy)benzene, 98% (CAS 115467-07-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094155-1G |
| cas | 115467-07-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 294.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-1,3-difluoro-2-(trifluoromethoxy)benzene (CAS 115467-07-7) is a chemical compound with the molecular formula C7H2BrF5O and a molecular weight of 276.99 g/mol. IUPAC name: 5-bromo-1,3-difluoro-2-(trifluoromethoxy)benzene. InChIKey: ORHCJZZKAUAZDR-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5O |
|---|---|
| Molecular weight | 276.99 g/mol |
| IUPAC name | 5-bromo-1,3-difluoro-2-(trifluoromethoxy)benzene |
| InChIKey | ORHCJZZKAUAZDR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OC(F)(F)F)F)Br |
Computed by PubChem (NCBI)