Products 1417568-00-3
CAS 1417568-00-3 is the registry number for 2-Bromo-1,3-difluoro-5-(trifluoromethoxy)benzene. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-bromo-1,3-difluoro-5-(trifluoromethoxy)benzene (CAS 1417568-00-3) is a chemical compound with the molecular formula C7H2BrF5O and a molecular weight of 276.99 g/mol. IUPAC name: 2-bromo-1,3-difluoro-5-(trifluoromethoxy)benzene. InChIKey: MGSXSXJQGYMGIG-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5O |
|---|---|
| Molecular weight | 276.99 g/mol |
| IUPAC name | 2-bromo-1,3-difluoro-5-(trifluoromethoxy)benzene |
| InChIKey | MGSXSXJQGYMGIG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Br)F)OC(F)(F)F |
Computed by PubChem (NCBI)