cas: 156243-64-0 — see every product listed under this CAS number, including other names
5-Bromo-1,3-difluoro-2-(trifluoromethyl)benzene 97% (CAS 156243-64-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A224310-250mg |
| cas | 156243-64-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 353.69 Pln | |
| Ambeed | 25g | 720.81 Pln | |
| Ambeed | 100g | 2584.25 Pln | |
| Ambeed | 500g | 10026.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A224310 |
5-bromo-1,3-difluoro-2-(trifluoromethyl)benzene (CAS 156243-64-0) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 5-bromo-1,3-difluoro-2-(trifluoromethyl)benzene. InChIKey: QPJKIRNIIXIPIE-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 5-bromo-1,3-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | QPJKIRNIIXIPIE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(F)(F)F)F)Br |
Computed by PubChem (NCBI)