cas: 156243-64-0 — see every product listed under this CAS number, including other names
4-Bromo-2,6-difluorobenzotrifluoride, 97% (CAS 156243-64-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038532-1G |
| cas | 156243-64-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 10g | 346.77 Pln | |
| Fluorochem | 25g | 726.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-1,3-difluoro-2-(trifluoromethyl)benzene (CAS 156243-64-0) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 5-bromo-1,3-difluoro-2-(trifluoromethyl)benzene. InChIKey: QPJKIRNIIXIPIE-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 5-bromo-1,3-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | QPJKIRNIIXIPIE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(F)(F)F)F)Br |
Computed by PubChem (NCBI)