CAS 1173721-45-3 appears in our catalog under these names: 5-Bromo-1-methyl-1H-pyrrolo[2,3-b]pyridine-2,3-dione, 98%, 98%, 5-Bromo-1-methyl-1H-pyrrolo[2,3-b]pyridine-2,3-dione, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1-methylpyrrolo[2,3-b]pyridine-2,3-dione (CAS 1173721-45-3) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 5-bromo-1-methylpyrrolo[2,3-b]pyridine-2,3-dione. InChIKey: AJQKBOXVCYDTSS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-bromo-1-methylpyrrolo[2,3-b]pyridine-2,3-dione |
| InChIKey | AJQKBOXVCYDTSS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=N2)Br)C(=O)C1=O |
Computed by PubChem (NCBI)