CAS 953409-99-9 appears in our catalog under these names: 5-Bromo-1h-indazole-7-carboxylic acid, 97%, 5-Bromo-1H-indazole-7-carboxylic acid, 96%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 500mg, 25g.
5-bromo-1H-indazole-7-carboxylic acid (CAS 953409-99-9) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 5-bromo-1H-indazole-7-carboxylic acid. InChIKey: HBCUQNYHXNSYGH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-bromo-1H-indazole-7-carboxylic acid |
| InChIKey | HBCUQNYHXNSYGH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NN2)C(=O)O)Br |
Computed by PubChem (NCBI)