cas: 690632-00-9 — see every product listed under this CAS number, including other names
5-Bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride, 98% (CAS 690632-00-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F651793-100MG |
| cas | 690632-00-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 500mg | 659.16 Pln | |
| Fluorochem | 1g | 862.21 Pln | |
| Fluorochem | 2.5g | 2080.54 Pln | |
| Fluorochem | 5g | 2981.26 Pln | |
| Fluorochem | 10g | 5850.04 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride (CAS 690632-00-9) is a chemical compound with the molecular formula C8H6BrClO3S and a molecular weight of 297.55 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride. InChIKey: WDCSWTWTTAMPFJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO3S |
|---|---|
| Molecular weight | 297.55 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride |
| InChIKey | WDCSWTWTTAMPFJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)