cas: 690632-00-9 — see every product listed under this CAS number, including other names
5-Bromo-2,3-dihydrobenzofuran-7-sulfonyl chloride, 98%, 98% (CAS 690632-00-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116LRY-100mg |
| cas | 690632-00-9 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 2426.00 Pln | |
| Chemat | 10g | 4581.20 Pln | |
| Chemat | 25g | 5622.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride (CAS 690632-00-9) is a chemical compound with the molecular formula C8H6BrClO3S and a molecular weight of 297.55 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride. InChIKey: WDCSWTWTTAMPFJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO3S |
|---|---|
| Molecular weight | 297.55 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride |
| InChIKey | WDCSWTWTTAMPFJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)