cas: 433922-57-7 — see every product listed under this CAS number, including other names
5-Bromo-2-(1H-pyrazol-1-yl)pyridine, 95%+, 95%+ (CAS 433922-57-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MFT-100mg |
| cas | 433922-57-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1931.60 Pln | |
| Chemat | 10g | 3746.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-pyrazol-1-ylpyridine (CAS 433922-57-7) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 5-bromo-2-pyrazol-1-ylpyridine. InChIKey: AAZVSSMAJOIOOI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 5-bromo-2-pyrazol-1-ylpyridine |
| InChIKey | AAZVSSMAJOIOOI-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)