cas: 181806-67-7 — see every product listed under this CAS number, including other names
5-Bromo-2-(Difluoromethoxy)-1,3-Difluorobenzene, 95%, 95% (CAS 181806-67-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11344V-100mg |
| cas | 181806-67-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1024.40 Pln | |
| Chemat | 1g | 1970.00 Pln | |
| Chemat | 5g | 6400.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-(difluoromethoxy)-1,3-difluorobenzene (CAS 181806-67-7) is a chemical compound with the molecular formula C7H3BrF4O and a molecular weight of 259.00 g/mol. IUPAC name: 5-bromo-2-(difluoromethoxy)-1,3-difluorobenzene. InChIKey: ZZIBINAQRAEVEO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4O |
|---|---|
| Molecular weight | 259.00 g/mol |
| IUPAC name | 5-bromo-2-(difluoromethoxy)-1,3-difluorobenzene |
| InChIKey | ZZIBINAQRAEVEO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OC(F)F)F)Br |
Computed by PubChem (NCBI)