cas: 29241-65-4 — see every product listed under this CAS number, including other names
5-Bromo-2-chloronicotinic acid 97% (CAS 29241-65-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A183534-1g |
| cas | 29241-65-4 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 409.31 Pln | |
| Ambeed | 500g | 1766.56 Pln | |
| Ambeed | 1000g | 3435.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A183534 |
5-bromo-2-chloropyridine-3-carboxylic acid (CAS 29241-65-4) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3-carboxylic acid. InChIKey: UKNYSJCAGUXDOQ-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-3-carboxylic acid |
| InChIKey | UKNYSJCAGUXDOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Cl)Br |
Computed by PubChem (NCBI)