CAS 29241-65-4 appears in our catalog under these names: 5–Bromo–2–chloronicotinic Acid, 5-Bromo-2-chloronicotinic acid, 96% , 5-Bromo-2-chloronicotinic Acid, >98.0%(GC)(T), 5-Bromo-2-chloronicotinic acid 97%, 5-Bromo-2-chloronicotinic Acid, 99%, 99%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g, 1000g, 50g.
5-bromo-2-chloropyridine-3-carboxylic acid (CAS 29241-65-4) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3-carboxylic acid. InChIKey: UKNYSJCAGUXDOQ-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-3-carboxylic acid |
| InChIKey | UKNYSJCAGUXDOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Cl)Br |
Computed by PubChem (NCBI)