cas: 688047-09-8 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxy-4-(trifluoromethyl)pyridine, 98% (CAS 688047-09-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F626545-100MG |
| cas | 688047-09-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 643.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-2-methoxy-4-(trifluoromethyl)pyridine (CAS 688047-09-8) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 5-bromo-2-methoxy-4-(trifluoromethyl)pyridine. InChIKey: YNBRJYBSNIWSTM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 5-bromo-2-methoxy-4-(trifluoromethyl)pyridine |
| InChIKey | YNBRJYBSNIWSTM-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)