cas: 886365-22-6 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxyisonicotinic acid 97% (CAS 886365-22-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A383194-10g |
| cas | 886365-22-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1577.44 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1010.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A383194 |
5-bromo-2-methoxypyridine-4-carboxylic acid (CAS 886365-22-6) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 5-bromo-2-methoxypyridine-4-carboxylic acid. InChIKey: JZBHBRMXZANNNF-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-bromo-2-methoxypyridine-4-carboxylic acid |
| InChIKey | JZBHBRMXZANNNF-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)