CAS 26647-60-9 is the registry number for 2-(Bromomethyl)-5-nitrophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(bromomethyl)-5-nitrophenol (CAS 26647-60-9) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 2-(bromomethyl)-5-nitrophenol. InChIKey: GFIKQUPVPVZTKV-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 2-(bromomethyl)-5-nitrophenol |
| InChIKey | GFIKQUPVPVZTKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])O)CBr |
Computed by PubChem (NCBI)