cas: 1013-83-8 — see every product listed under this CAS number, including other names
5-Bromo-2-naphthoic acid 95% (CAS 1013-83-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A167398-500g |
| cas | 1013-83-8 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 15973.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 398.19 Pln | |
| Ambeed | 10g | 665.19 Pln | |
| Ambeed | 25g | 1499.56 Pln | |
| Ambeed | 100g | 4047.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A167398 |
5-bromonaphthalene-2-carboxylic acid (CAS 1013-83-8) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 5-bromonaphthalene-2-carboxylic acid. InChIKey: QPOQPJDDJJNVRY-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 5-bromonaphthalene-2-carboxylic acid |
| InChIKey | QPOQPJDDJJNVRY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)C(=C1)Br |
Computed by PubChem (NCBI)