cas: 82299-36-3 — see every product listed under this CAS number, including other names
5-Bromo-2H-1,3-benzodioxol-4-ol (CAS 82299-36-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630264-1G |
| cas | 82299-36-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4600.48 Pln | |
| Fluorochem | 5g | 13685.82 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-1,3-benzodioxol-4-ol (CAS 82299-36-3) is a chemical compound with the molecular formula C7H5BrO3 and a molecular weight of 217.02 g/mol. IUPAC name: 5-bromo-1,3-benzodioxol-4-ol. InChIKey: FSDSDUFDWODBBX-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO3 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 5-bromo-1,3-benzodioxol-4-ol |
| InChIKey | FSDSDUFDWODBBX-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)O |
Computed by PubChem (NCBI)