cas: 1150618-36-2 — see every product listed under this CAS number, including other names
5-Bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine, 95%, 95% (CAS 1150618-36-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FU2-100mg |
| cas | 1150618-36-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 3011.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1150618-36-2) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 5-bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: UVCPMKCLEJTRCP-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 5-bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | UVCPMKCLEJTRCP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)C(F)(F)F)Br |
Computed by PubChem (NCBI)