cas: 1003298-75-6 — see every product listed under this CAS number, including other names
5-Bromo-3-fluoro-2-(phenylmethoxy)benzaldehyde, (CAS 1003298-75-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629761-1G |
| cas | 1003298-75-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3074.98 Pln | |
| Fluorochem | 5g | 9088.48 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-3-fluoro-2-phenylmethoxybenzaldehyde (CAS 1003298-75-6) is a chemical compound with the molecular formula C14H10BrFO2 and a molecular weight of 309.13 g/mol. IUPAC name: 5-bromo-3-fluoro-2-phenylmethoxybenzaldehyde. InChIKey: BZUGACPNEXNCFI-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO2 |
|---|---|
| Molecular weight | 309.13 g/mol |
| IUPAC name | 5-bromo-3-fluoro-2-phenylmethoxybenzaldehyde |
| InChIKey | BZUGACPNEXNCFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)Br)C=O |
Computed by PubChem (NCBI)