cas: 934000-34-7 — see every product listed under this CAS number, including other names
5-Bromo-3-methyl-2-[(piperidin-1-yl)carbonyl]pyridine, 97% (CAS 934000-34-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632958-500MG |
| cas | 934000-34-7 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 409.25 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 5g | 1830.62 Pln | |
| Fluorochem | 10g | 3090.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(5-bromo-3-methyl-2-pyridinyl)-piperidin-1-ylmethanone (CAS 934000-34-7) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: (5-bromo-3-methyl-2-pyridinyl)-piperidin-1-ylmethanone. InChIKey: SSTNQXQJPDTGGL-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | (5-bromo-3-methyl-2-pyridinyl)-piperidin-1-ylmethanone |
| InChIKey | SSTNQXQJPDTGGL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)N2CCCCC2)Br |
Computed by PubChem (NCBI)