cas: 15862-34-7 — see every product listed under this CAS number, including other names
5-Bromo-3-nitropyridin-2(1H)-one 98% HPLC (CAS 15862-34-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A280340-5g |
| cas | 15862-34-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 426.00 Pln |
| purity | 98% HPLC |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A280340 |
5-bromo-3-nitro-1H-pyridin-2-one (CAS 15862-34-7) is a chemical compound with the molecular formula C5H3BrN2O3 and a molecular weight of 218.99 g/mol. IUPAC name: 5-bromo-3-nitro-1H-pyridin-2-one. InChIKey: WXRLCVUDLFFTFF-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O3 |
|---|---|
| Molecular weight | 218.99 g/mol |
| IUPAC name | 5-bromo-3-nitro-1H-pyridin-2-one |
| InChIKey | WXRLCVUDLFFTFF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)