cas: 15862-34-7 — see every product listed under this CAS number, including other names
5-Bromo-3-nitropyridin-2(1H)-one, 99.10% (CAS 15862-34-7) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 25 g, 5 g, 500 g, 100 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W002138-50 g |
| cas | 15862-34-7 |
| size | 50 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 886.26 Pln | |
| MedChemExpress | 25 g | 598.33 Pln | |
| MedChemExpress | 5 g | 263.96 Pln | |
| MedChemExpress | 500 g | 3189.68 Pln | |
| MedChemExpress | 100 g | 1346.02 Pln | |
| MedChemExpress | 10 g | 361.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.10% |
5-bromo-3-nitro-1H-pyridin-2-one (CAS 15862-34-7) is a chemical compound with the molecular formula C5H3BrN2O3 and a molecular weight of 218.99 g/mol. IUPAC name: 5-bromo-3-nitro-1H-pyridin-2-one. InChIKey: WXRLCVUDLFFTFF-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O3 |
|---|---|
| Molecular weight | 218.99 g/mol |
| IUPAC name | 5-bromo-3-nitro-1H-pyridin-2-one |
| InChIKey | WXRLCVUDLFFTFF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)