cas: 15862-34-7 — see every product listed under this CAS number, including other names
5-Bromo-2-hydroxy-3-nitropyridine, 97% (CAS 15862-34-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F017235-1G |
| cas | 15862-34-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 25g | 154.13 Pln | |
| Fluorochem | 100g | 388.42 Pln | |
| Fluorochem | 250g | 862.21 Pln | |
| Fluorochem | 500g | 1549.47 Pln | |
| Fluorochem | 1kg | 2825.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-3-nitro-1H-pyridin-2-one (CAS 15862-34-7) is a chemical compound with the molecular formula C5H3BrN2O3 and a molecular weight of 218.99 g/mol. IUPAC name: 5-bromo-3-nitro-1H-pyridin-2-one. InChIKey: WXRLCVUDLFFTFF-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O3 |
|---|---|
| Molecular weight | 218.99 g/mol |
| IUPAC name | 5-bromo-3-nitro-1H-pyridin-2-one |
| InChIKey | WXRLCVUDLFFTFF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)