CAS 167683-72-9 is the registry number for 2-bromo-6-nitropyridin-3-ol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-bromo-6-nitropyridin-3-ol (CAS 167683-72-9) is a chemical compound with the molecular formula C5H3BrN2O3 and a molecular weight of 218.99 g/mol. IUPAC name: 2-bromo-6-nitropyridin-3-ol. InChIKey: GRTNGVHJAZEBEH-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O3 |
|---|---|
| Molecular weight | 218.99 g/mol |
| IUPAC name | 2-bromo-6-nitropyridin-3-ol |
| InChIKey | GRTNGVHJAZEBEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)