cas: 1374258-43-1 — see every product listed under this CAS number, including other names
5-Bromo-7-(trifluoromethyl)-1H-indazole, 98%, 98% (CAS 1374258-43-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WJJ-100mg |
| cas | 1374258-43-1 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 1322.00 Pln | |
| Chemat | 10g | 2320.40 Pln | |
| Chemat | 25g | 4802.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-7-(trifluoromethyl)-1H-indazole (CAS 1374258-43-1) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 5-bromo-7-(trifluoromethyl)-1H-indazole. InChIKey: YLMFTTBYMVQLMH-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 5-bromo-7-(trifluoromethyl)-1H-indazole |
| InChIKey | YLMFTTBYMVQLMH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NN2)C(F)(F)F)Br |
Computed by PubChem (NCBI)