CAS 2227206-68-8 appears in our catalog under these names: 5–Bromo–8–chloroquinoxaline, 5-Bromo-8-chloroquinoxaline, 95%, 5-Bromo-8-chloroquinoxaline, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg.
5-bromo-8-chloroquinoxaline (CAS 2227206-68-8) is a chemical compound with the molecular formula C8H4BrClN2 and a molecular weight of 243.49 g/mol. IUPAC name: 5-bromo-8-chloroquinoxaline. InChIKey: BGWUYJKYLKDGCF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2 |
|---|---|
| Molecular weight | 243.49 g/mol |
| IUPAC name | 5-bromo-8-chloroquinoxaline |
| InChIKey | BGWUYJKYLKDGCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)N=CC=N2)Br |
Computed by PubChem (NCBI)