cas: 1033202-38-8 — see every product listed under this CAS number, including other names
5-Bromo-N-cyclohexyl-3-nitropyridin-2-amine, 98% (CAS 1033202-38-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A551177-500g |
| cas | 1033202-38-8 |
| size | 500g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 500g | 8244.48 Pln | |
| AmBeed | 5g | 278.32 Pln | |
| AmBeed | 1g | 154.63 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-N-cyclohexyl-3-nitropyridin-2-amine (CAS 1033202-38-8) is a chemical compound with the molecular formula C11H14BrN3O2 and a molecular weight of 300.15 g/mol. IUPAC name: 5-bromo-N-cyclohexyl-3-nitropyridin-2-amine. InChIKey: VZBKXAUXUUUXMA-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O2 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 5-bromo-N-cyclohexyl-3-nitropyridin-2-amine |
| InChIKey | VZBKXAUXUUUXMA-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=C(C=C(C=N2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)