CAS 1096428-38-4 is the registry number for 2-((4-Bromo-3-methylphenyl)amino)-N-carbamoylpropanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromo-3-methylanilino)-N-carbamoylpropanamide (CAS 1096428-38-4) is a chemical compound with the molecular formula C11H14BrN3O2 and a molecular weight of 300.15 g/mol. IUPAC name: 2-(4-bromo-3-methylanilino)-N-carbamoylpropanamide. InChIKey: UCTCVEWZOHNJOA-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O2 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 2-(4-bromo-3-methylanilino)-N-carbamoylpropanamide |
| InChIKey | UCTCVEWZOHNJOA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(C)C(=O)NC(=O)N)Br |
Computed by PubChem (NCBI)