CAS 1016837-21-0 is the registry number for 1-(4-Bromo-2-nitrophenyl)-1,4-diazepane, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-2-nitrophenyl)-1,4-diazepane (CAS 1016837-21-0) is a chemical compound with the molecular formula C11H14BrN3O2 and a molecular weight of 300.15 g/mol. IUPAC name: 1-(4-bromo-2-nitrophenyl)-1,4-diazepane. InChIKey: DAETUMFJCFGOEV-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O2 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 1-(4-bromo-2-nitrophenyl)-1,4-diazepane |
| InChIKey | DAETUMFJCFGOEV-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(C=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)