CAS 477846-54-1 is the registry number for 1-(2-Bromo-4-nitrophenyl)-4-methylpiperazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-(2-bromo-4-nitrophenyl)-4-methylpiperazine (CAS 477846-54-1) is a chemical compound with the molecular formula C11H14BrN3O2 and a molecular weight of 300.15 g/mol. IUPAC name: 1-(2-bromo-4-nitrophenyl)-4-methylpiperazine. InChIKey: WDTGICOJIRJONX-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O2 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 1-(2-bromo-4-nitrophenyl)-4-methylpiperazine |
| InChIKey | WDTGICOJIRJONX-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)