cas: 342013-85-8 — see every product listed under this CAS number, including other names
5-Bromo-N-cyclohexylnicotinamide (CAS 342013-85-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212779-1G |
| cas | 342013-85-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 2658.46 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-N-cyclohexylpyridine-3-carboxamide (CAS 342013-85-8) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: 5-bromo-N-cyclohexylpyridine-3-carboxamide. InChIKey: ARXZGDIGMTXOQM-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 5-bromo-N-cyclohexylpyridine-3-carboxamide |
| InChIKey | ARXZGDIGMTXOQM-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)