cas: 1451392-88-3 — see every product listed under this CAS number, including other names
5-Bromobenzo[1,3]dioxole-4-boronic acid (CAS 1451392-88-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627952-5G |
| cas | 1451392-88-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1783.76 Pln | |
| Fluorochem | 10g | 2976.05 Pln |
| delivery time | 3-4 weeks |
|---|
(5-bromo-1,3-benzodioxol-4-yl)boronic acid (CAS 1451392-88-3) is a chemical compound with the molecular formula C7H6BBrO4 and a molecular weight of 244.84 g/mol. IUPAC name: (5-bromo-1,3-benzodioxol-4-yl)boronic acid. InChIKey: QYRRTVQPTCHAGY-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrO4 |
|---|---|
| Molecular weight | 244.84 g/mol |
| IUPAC name | (5-bromo-1,3-benzodioxol-4-yl)boronic acid |
| InChIKey | QYRRTVQPTCHAGY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC2=C1OCO2)Br)(O)O |
Computed by PubChem (NCBI)