5-Bromobenzo[b]thiophene-2-carboxylic acid, 95%
cas: 7312-10-9 — see every product listed under this CAS number, including other names
5-Bromobenzo[b]thiophene-2-carboxylic acid, 95% (CAS 7312-10-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A578814-1g |
| cas | 7312-10-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 248.00 Pln | |
| Ambeed | 25g | 498.31 Pln | |
| Ambeed | 100g | 1616.38 Pln | |
| Ambeed | 500g | 6978.62 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 264.38 Pln | |
| BLDpharm | 25g | 530.95 Pln | |
| BLDpharm | 100g | 1736.08 Pln | |
| BLDpharm | 500g | 7522.93 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-1-benzothiophene-2-carboxylic acid (CAS 7312-10-9) is a chemical compound with the molecular formula C9H5BrO2S and a molecular weight of 257.11 g/mol. IUPAC name: 5-bromo-1-benzothiophene-2-carboxylic acid. InChIKey: ONNFNEFYXIPHCA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 5-bromo-1-benzothiophene-2-carboxylic acid |
| InChIKey | ONNFNEFYXIPHCA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(S2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Bromo-benzo[b]thiophene-2-carboxylic acid, 5-Bromo-benzo(b)thiophene-2-carboxylic acid, 5-bromo-1-benzothiophene-2-carboxylic acid, 5-bromobenzo[b]thiophene-2-carboxylic acid, Benzo[b]thiophene-2-carboxylic acid, 5-bromo-, 5-bromobenzothiophene-2-carboxylic acid, ONNFNEFYXIPHCA-UHFFFAOYSA-N, 5-bromo-1-benzothiophene-2-carboxylic acid, AldrichCPR