cas: 4333-22-6 — see every product listed under this CAS number, including other names
5-Butyl-3-phenyl-2-thioxoimidazolidin-4-one (CAS 4333-22-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F773853-100MG |
| cas | 4333-22-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 500mg | 633.13 Pln | |
| Fluorochem | 1g | 820.56 Pln | |
| Fluorochem | 5g | 2434.58 Pln |
| delivery time | 3-4 weeks |
|---|
5-butyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (CAS 4333-22-6) is a chemical compound with the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. IUPAC name: 5-butyl-3-phenyl-2-sulfanylideneimidazolidin-4-one. InChIKey: FJQCWUDEVCYMRZ-UHFFFAOYSA-N.
| Molecular formula | C13H16N2OS |
|---|---|
| Molecular weight | 248.35 g/mol |
| IUPAC name | 5-butyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| InChIKey | FJQCWUDEVCYMRZ-UHFFFAOYSA-N |
| SMILES | CCCCC1C(=O)N(C(=S)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)