cas: 4897-25-0 — see every product listed under this CAS number, including other names
5-Chloro-1-methyl-4-nitroimidazole, 97%, 97% (CAS 4897-25-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MLS-5g |
| cas | 4897-25-0 |
| size | 5g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 170.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-1-methyl-4-nitroimidazole (CAS 4897-25-0) is a chemical compound with the molecular formula C4H4ClN3O2 and a molecular weight of 161.55 g/mol. IUPAC name: 5-chloro-1-methyl-4-nitroimidazole. InChIKey: OSJUNMSWBBOTQU-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN3O2 |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | 5-chloro-1-methyl-4-nitroimidazole |
| InChIKey | OSJUNMSWBBOTQU-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)