5-Chloro-1H-indol-3-amine hydrochloride, 95%
cas: 2470435-57-3 — see every product listed under this CAS number, including other names
5-Chloro-1H-indol-3-amine hydrochloride, 95% (CAS 2470435-57-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1507629-250mg |
| cas | 2470435-57-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2300.56 Pln | |
| Ambeed | 1g | 5882.81 Pln | |
| Ambeed | 5g | 16946.62 Pln | |
| BLDpharm | 100mg | 1441.74 Pln | |
| BLDpharm | 250mg | 2263.67 Pln | |
| BLDpharm | 1g | 5767.99 Pln | |
| BLDpharm | 5g | 18263.59 Pln | |
| Chemat | 100mg | 1077.20 Pln | |
| Chemat | 250mg | 1686.80 Pln | |
| Chemat | 1g | 4283.60 Pln | |
| Chemat | 5g | 14829.20 Pln | |
| Fluorochem | 100mg | 1992.02 Pln | |
| Fluorochem | 250mg | 3142.66 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-chloro-1H-indol-3-amine;hydrochloride (CAS 2470435-57-3) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 5-chloro-1H-indol-3-amine;hydrochloride. InChIKey: FMLNFSLZKDPARO-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 5-chloro-1H-indol-3-amine;hydrochloride |
| InChIKey | FMLNFSLZKDPARO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)N.Cl |
Computed by PubChem (NCBI)