CAS 49704-71-4 appears in our catalog under these names: 2-Amino-2-(4-chlorophenyl)acetonitrile hydrochloride, 2-Amino-2-(4-chlorophenyl)acetonitrile hydrochloride, 95%, 2-Amino-2-(4-chlorophenyl)acetonitrile hydrochloride, 97%, 2-Amino-2-(4-chlorophenyl)acetonitrile hydrochloride, 97%, 97%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
2-amino-2-(4-chlorophenyl)acetonitrile;hydrochloride (CAS 49704-71-4) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 2-amino-2-(4-chlorophenyl)acetonitrile;hydrochloride. InChIKey: SVGCEBDJOXZLMJ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 2-amino-2-(4-chlorophenyl)acetonitrile;hydrochloride |
| InChIKey | SVGCEBDJOXZLMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C#N)N)Cl.Cl |
Computed by PubChem (NCBI)