CAS 900514-05-8 appears in our catalog under these names: 5-Chloromethyl-1h-pyrrolo[2,3-b]pyridine hydrochloride, 95%, 5-(Chloromethyl)-1H-pyrrolo(2,3-b)pyridine hydrochloride, 98+%, 5-Chloromethyl-1H-pyrrolo(2,3-b)pyridine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.
5-(chloromethyl)-1H-pyrrolo[2,3-b]pyridine;hydrochloride (CAS 900514-05-8) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 5-(chloromethyl)-1H-pyrrolo[2,3-b]pyridine;hydrochloride. InChIKey: CDUSDQWROLIRTH-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 5-(chloromethyl)-1H-pyrrolo[2,3-b]pyridine;hydrochloride |
| InChIKey | CDUSDQWROLIRTH-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C=C21)CCl.Cl |
Computed by PubChem (NCBI)