CAS 1260753-25-0 is the registry number for 4-(Azetidin-3-yl)-2,5-dichloropyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(azetidin-3-yl)-2,5-dichloropyridine (CAS 1260753-25-0) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 4-(azetidin-3-yl)-2,5-dichloropyridine. InChIKey: JCIYVIZMIIJIMT-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 4-(azetidin-3-yl)-2,5-dichloropyridine |
| InChIKey | JCIYVIZMIIJIMT-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC(=NC=C2Cl)Cl |
Computed by PubChem (NCBI)