cas: 1692200-42-2 — see every product listed under this CAS number, including other names
5-Chloro-2',3',5',6'-tetrahydrospiro(indoline-3,4'-pyran), 98% (CAS 1692200-42-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1418751-1g |
| cas | 1692200-42-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 17842.30 Pln | |
| AmBeed | 250mg | 7178.92 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chlorospiro[1,2-dihydroindole-3,4'-oxane] (CAS 1692200-42-2) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: 5-chlorospiro[1,2-dihydroindole-3,4'-oxane]. InChIKey: KCLFGBZLSPZLSU-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 5-chlorospiro[1,2-dihydroindole-3,4'-oxane] |
| InChIKey | KCLFGBZLSPZLSU-UHFFFAOYSA-N |
| SMILES | C1COCCC12CNC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)