cas: 38275-34-2 — see every product listed under this CAS number, including other names
5-Chloro-2-(methylsulfonyl)pyrimidine-4-carboxylic acid, 98%, 98% (CAS 38275-34-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CM6D-1mg |
| cas | 38275-34-2 |
| size | 1mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 5mg | 98.00 Pln | |
| Chemat | 10mg | 102.80 Pln | |
| Chemat | 25mg | 122.00 Pln | |
| Chemat | 50mg | 136.40 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 1317.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2-methylsulfonylpyrimidine-4-carboxylic acid (CAS 38275-34-2) is a chemical compound with the molecular formula C6H5ClN2O4S and a molecular weight of 236.63 g/mol. IUPAC name: 5-chloro-2-methylsulfonylpyrimidine-4-carboxylic acid. InChIKey: WZUPWJVRWIVWEF-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O4S |
|---|---|
| Molecular weight | 236.63 g/mol |
| IUPAC name | 5-chloro-2-methylsulfonylpyrimidine-4-carboxylic acid |
| InChIKey | WZUPWJVRWIVWEF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C(C(=N1)C(=O)O)Cl |
Computed by PubChem (NCBI)