CAS 38275-34-2 appears in our catalog under these names: PK11000/ 100%, PK11007, 5-Chloro-2-(methylsulfonyl)pyrimidine-4-carboxylic acid, 98%, 98%, PK11000, 99.56%, 5-Chloro-2-(methylsulfonyl)pyrimidine-4-carboxylic acid, 97%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 5g, 0,5g.
5-chloro-2-methylsulfonylpyrimidine-4-carboxylic acid (CAS 38275-34-2) is a chemical compound with the molecular formula C6H5ClN2O4S and a molecular weight of 236.63 g/mol. IUPAC name: 5-chloro-2-methylsulfonylpyrimidine-4-carboxylic acid. InChIKey: WZUPWJVRWIVWEF-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O4S |
|---|---|
| Molecular weight | 236.63 g/mol |
| IUPAC name | 5-chloro-2-methylsulfonylpyrimidine-4-carboxylic acid |
| InChIKey | WZUPWJVRWIVWEF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C(C(=N1)C(=O)O)Cl |
Computed by PubChem (NCBI)