cas: 1383446-21-6 — see every product listed under this CAS number, including other names
5-Chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)pyridine, 95+% (CAS 1383446-21-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A726067-25g |
| cas | 1383446-21-6 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 17926.93 Pln | |
| AmBeed | 10g | 9125.41 Pln | |
| AmBeed | 5g | 5401.69 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)pyridine (CAS 1383446-21-6) is a chemical compound with the molecular formula C12H15ClFNO2 and a molecular weight of 259.70 g/mol. IUPAC name: 5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)pyridine. InChIKey: JDBZHAVFXHSNTO-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO2 |
|---|---|
| Molecular weight | 259.70 g/mol |
| IUPAC name | 5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)pyridine |
| InChIKey | JDBZHAVFXHSNTO-UHFFFAOYSA-N |
| SMILES | CC1(C(OC(O1)C2=C(N=CC(=C2)Cl)F)(C)C)C |
Computed by PubChem (NCBI)