cas: 1383446-21-6 — see every product listed under this CAS number, including other names
5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)pyridine, ≥95%, ≥95% (CAS 1383446-21-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DNKI-1g |
| cas | 1383446-21-6 |
| size | 1g |
| availability | 33g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 774.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)pyridine (CAS 1383446-21-6) is a chemical compound with the molecular formula C12H15ClFNO2 and a molecular weight of 259.70 g/mol. IUPAC name: 5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)pyridine. InChIKey: JDBZHAVFXHSNTO-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO2 |
|---|---|
| Molecular weight | 259.70 g/mol |
| IUPAC name | 5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)pyridine |
| InChIKey | JDBZHAVFXHSNTO-UHFFFAOYSA-N |
| SMILES | CC1(C(OC(O1)C2=C(N=CC(=C2)Cl)F)(C)C)C |
Computed by PubChem (NCBI)