cas: 23746-76-1 — see every product listed under this CAS number, including other names
5-Chloro-2-phenyl-1H-indole, 95%, 95% (CAS 23746-76-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5L0-50mg |
| cas | 23746-76-1 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 179.60 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 803.60 Pln | |
| Chemat | 5g | 2243.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2-phenyl-1H-indole (CAS 23746-76-1) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 5-chloro-2-phenyl-1H-indole. InChIKey: GQGZSWYJDNGSBE-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 5-chloro-2-phenyl-1H-indole |
| InChIKey | GQGZSWYJDNGSBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)