cas: 138035-68-4 — see every product listed under this CAS number, including other names
5-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one, 95+%, 95+% (CAS 138035-68-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128W5-100mg |
| cas | 138035-68-4 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 573.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
5-chloro-4H-1,4-benzoxazin-3-one (CAS 138035-68-4) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 5-chloro-4H-1,4-benzoxazin-3-one. InChIKey: WGLKZFRQDQEPMU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 5-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | WGLKZFRQDQEPMU-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC=C2Cl |
Computed by PubChem (NCBI)