cas: 57800-76-7 — see every product listed under this CAS number, including other names
5-Chloro-4-nitrothiophene-2-carboxylic acid methyl ester 95% (CAS 57800-76-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A503245-100mg |
| cas | 57800-76-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 542.81 Pln | |
| Ambeed | 25g | 1010.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A503245 |
Methyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS 57800-76-7) is a chemical compound with the molecular formula C6H4ClNO4S and a molecular weight of 221.62 g/mol. IUPAC name: methyl 5-chloro-4-nitrothiophene-2-carboxylate. InChIKey: IJSXVHIIYIMVTM-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO4S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | methyl 5-chloro-4-nitrothiophene-2-carboxylate |
| InChIKey | IJSXVHIIYIMVTM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(S1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)