cas: 57800-76-7 — see every product listed under this CAS number, including other names
METHYL 5-CHLORO-4-NITROTHIOPHENE-2-CARBOXYLATE, 97% (CAS 57800-76-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386231-250MG |
| cas | 57800-76-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 315.53 Pln | |
| Fluorochem | 10g | 529.00 Pln | |
| Fluorochem | 25g | 1002.79 Pln | |
| Fluorochem | 100g | 3845.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS 57800-76-7) is a chemical compound with the molecular formula C6H4ClNO4S and a molecular weight of 221.62 g/mol. IUPAC name: methyl 5-chloro-4-nitrothiophene-2-carboxylate. InChIKey: IJSXVHIIYIMVTM-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO4S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | methyl 5-chloro-4-nitrothiophene-2-carboxylate |
| InChIKey | IJSXVHIIYIMVTM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(S1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)