CAS 408327-32-2 appears in our catalog under these names: 5-Chloro-6-methoxy-2-naphthoic acid, 95%, 5-Chloro-6-methoxy-2-naphthoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-chloro-6-methoxynaphthalene-2-carboxylic acid (CAS 408327-32-2) is a chemical compound with the molecular formula C12H9ClO3 and a molecular weight of 236.65 g/mol. IUPAC name: 5-chloro-6-methoxynaphthalene-2-carboxylic acid. InChIKey: ROSQDPHSNSOGSS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO3 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 5-chloro-6-methoxynaphthalene-2-carboxylic acid |
| InChIKey | ROSQDPHSNSOGSS-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)